About trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine
trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine (PubChem CID 67785088) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine |
| PubChem CID | 67785088 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine |
| SMILES | CN[C@@H]1CCCC[C@H]1C1CNCCO1 |
| InChI | InChI=1S/C11H22N2O/c1-12-10-5-3-2-4-9(10)11-8-13-6-7-14-11/h9-13H,2-8H2,1H3/t9-,10-,11?/m1/s1 |
| InChIKey | XRPGFFFHTSOETC-DIOIDXFWSA-N |
| XLogP | 0.75 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine?
The IUPAC name of trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine (CID 67785088) is trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine.
What is the SMILES notation for trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine?
The canonical SMILES for trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine is CN[C@@H]1CCCC[C@H]1C1CNCCO1.
What is the InChIKey of trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine?
The InChIKey is XRPGFFFHTSOETC-DIOIDXFWSA-N. The full InChI is InChI=1S/C11H22N2O/c1-12-10-5-3-2-4-9(10)11-8-13-6-7-14-11/h9-13H,2-8H2,1H3/t9-,10-,11?/m1/s1.
What are the key properties of trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine?
trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine has a molecular weight of 198.31 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N-methyl-2-morpholin-2-ylcyclohexan-1-amine is sourced from PubChem (CID 67785088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).