About ethyl 2-(oxan-4-yl)ethenyl carbonate
ethyl 2-(oxan-4-yl)ethenyl carbonate (PubChem CID 67785520) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is ethyl 2-(oxan-4-yl)ethenyl carbonate.
Molecular Properties
| Compound Name | ethyl 2-(oxan-4-yl)ethenyl carbonate |
| PubChem CID | 67785520 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl 2-(oxan-4-yl)ethenyl carbonate |
| SMILES | CCOC(=O)OC=CC1CCOCC1 |
| InChI | InChI=1S/C10H16O4/c1-2-13-10(11)14-8-5-9-3-6-12-7-4-9/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | VPKYUOHYBYUWAZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(oxan-4-yl)ethenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(oxan-4-yl)ethenyl carbonate?
The IUPAC name of ethyl 2-(oxan-4-yl)ethenyl carbonate (CID 67785520) is ethyl 2-(oxan-4-yl)ethenyl carbonate.
What is the SMILES notation for ethyl 2-(oxan-4-yl)ethenyl carbonate?
The canonical SMILES for ethyl 2-(oxan-4-yl)ethenyl carbonate is CCOC(=O)OC=CC1CCOCC1.
What is the InChIKey of ethyl 2-(oxan-4-yl)ethenyl carbonate?
The InChIKey is VPKYUOHYBYUWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-2-13-10(11)14-8-5-9-3-6-12-7-4-9/h5,8-9H,2-4,6-7H2,1H3.
What are the key properties of ethyl 2-(oxan-4-yl)ethenyl carbonate?
ethyl 2-(oxan-4-yl)ethenyl carbonate has a molecular weight of 200.23 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(oxan-4-yl)ethenyl carbonate is sourced from PubChem (CID 67785520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).