C26H21N3O4S — CID 67785698
N-[2-(3,4-dihydro-2H-1,2-benzothiazin-4-yl)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide (PubChem CID 67785698) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-1,2-benzothiazin-4-yl)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide.
| Compound Name | N-[2-(3,4-dihydro-2H-1,2-benzothiazin-4-yl)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 67785698 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-1,2-benzothiazin-4-yl)-2-oxoethyl]-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide |
| SMILES | O=C(CN(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1)C1CNSc2ccccc21 |
| InChI | InChI=1S/C26H21N3O4S/c30-22(21-14-27-34-23-13-7-6-10-18(21)23)15-28(17-8-2-1-3-9-17)24(31)16-29-25(32)19-11-4-5-12-20(19)26(29)33/h1-13,21,27H,14-16H2 |
| InChIKey | UTLICJBVZDZINX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|