C17H14Cl2N2O4 — CID 67786419
3,5-dichloro-N-[2-(6-methoxy-3-oxido-1,3-benzoxazol-3-ium-2-yl)ethyl]benzamide (PubChem CID 67786419) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(6-methoxy-3-oxido-1,3-benzoxazol-3-ium-2-yl)ethyl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-(6-methoxy-3-oxido-1,3-benzoxazol-3-ium-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 67786419 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 3,5-dichloro-N-[2-(6-methoxy-3-oxido-1,3-benzoxazol-3-ium-2-yl)ethyl]benzamide |
| SMILES | COc1ccc2c(c1)oc(CCNC(=O)c1cc(Cl)cc(Cl)c1)[n+]2[O-] |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-24-13-2-3-14-15(9-13)25-16(21(14)23)4-5-20-17(22)10-6-11(18)8-12(19)7-10/h2-3,6-9H,4-5H2,1H3,(H,20,22) |
| InChIKey | QFFBOTPBABMDBV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|