C21H31NO5 — CID 67786588
(Z)-6-[2-(2-propoxypropan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 67786588) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is (Z)-6-[2-(2-propoxypropan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[2-(2-propoxypropan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 67786588 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (Z)-6-[2-(2-propoxypropan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | CCCOC(C)(C)C1OCC(C/C=C\CCC(=O)O)C(c2cccnc2)O1 |
| InChI | InChI=1S/C21H31NO5/c1-4-13-26-21(2,3)20-25-15-17(9-6-5-7-11-18(23)24)19(27-20)16-10-8-12-22-14-16/h5-6,8,10,12,14,17,19-20H,4,7,9,11,13,15H2,1-3H3,(H,23,24)/b6-5- |
| InChIKey | QYQWBJGPZIRGJL-WAYWQWQTSA-N |
| XLogP | 4.13 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|