About 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride
3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride (PubChem CID 67786646) has the molecular formula C11H18ClNO3
and a molecular weight of 247.72 g/mol. Its IUPAC name is 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride |
| PubChem CID | 67786646 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride |
| SMILES | CC(=O)CC(=O)O.CCC1=CC=CNC1.Cl |
| InChI | InChI=1S/C7H11N.C4H6O3.ClH/c1-2-7-4-3-5-8-6-7;1-3(5)2-4(6)7;/h3-5,8H,2,6H2,1H3;2H2,1H3,(H,6,7);1H |
| InChIKey | MOXOFSMPEGQNFN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride?
The IUPAC name of 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride (CID 67786646) is 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride.
What is the SMILES notation for 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride?
The canonical SMILES for 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride is CC(=O)CC(=O)O.CCC1=CC=CNC1.Cl.
What is the InChIKey of 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride?
The InChIKey is MOXOFSMPEGQNFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C4H6O3.ClH/c1-2-7-4-3-5-8-6-7;1-3(5)2-4(6)7;/h3-5,8H,2,6H2,1H3;2H2,1H3,(H,6,7);1H.
What are the key properties of 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride?
3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride has a molecular weight of 247.72 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2-dihydropyridine;3-oxobutanoic acid;hydrochloride is sourced from PubChem (CID 67786646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).