C22H30N2O4 — CID 67786808
5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 67786808) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 67786808 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cc(NCc2cc(O)ccc2O)ccc1O |
| InChI | InChI=1S/C22H30N2O4/c1-21(2,3)13-22(4,5)24-20(28)17-11-15(6-8-19(17)27)23-12-14-10-16(25)7-9-18(14)26/h6-11,23,25-27H,12-13H2,1-5H3,(H,24,28) |
| InChIKey | BUOXEXGLLHALNH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|