C20H26N2O7 — CID 67787974
6-[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 67787974) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is 6-[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | 6-[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 67787974 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 6-[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | C[C@H](NC(CCc1ccccc1)C(=O)O)C(=O)N1CC2OCCOC2C1C(=O)O |
| InChI | InChI=1S/C20H26N2O7/c1-12(21-14(19(24)25)8-7-13-5-3-2-4-6-13)18(23)22-11-15-17(16(22)20(26)27)29-10-9-28-15/h2-6,12,14-17,21H,7-11H2,1H3,(H,24,25)(H,26,27)/t12-,14?,15?,16?,17?/m0/s1 |
| InChIKey | SNQCMRKLYLWQBR-NICGVCSZSA-N |
| XLogP | 0.13 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |