C39H30N2O8 — CID 67788149
[4-[2-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]propan-2-yl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 67788149) has the molecular formula C39H30N2O8 and a molecular weight of 654.68 g/mol. Its IUPAC name is [4-[2-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]propan-2-yl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [4-[2-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]propan-2-yl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 67788149 |
| Molecular Formula | C39H30N2O8 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | [4-[2-[4-(1,3-dioxo-2-prop-2-enylisoindole-5-carbonyl)oxyphenyl]propan-2-yl]phenyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Oc3ccc(C(C)(C)c4ccc(OC(=O)c5ccc6c(c5)C(=O)N(CC=C)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C39H30N2O8/c1-5-19-40-33(42)29-17-7-23(21-31(29)35(40)44)37(46)48-27-13-9-25(10-14-27)39(3,4)26-11-15-28(16-12-26)49-38(47)24-8-18-30-32(22-24)36(45)41(20-6-2)34(30)43/h5-18,21-22H,1-2,19-20H2,3-4H3 |
| InChIKey | SMYOSVWABYGQJB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|