C41H57O3P — CID 67788223
trihydroxy-naphthalen-2-yl-[1-[3,6,8-tris(2-methylbutan-2-yl)naphthalen-2-yl]cyclohexyl]-λ5-phosphane (PubChem CID 67788223) has the molecular formula C41H57O3P and a molecular weight of 628.88 g/mol. Its IUPAC name is trihydroxy-naphthalen-2-yl-[1-[3,6,8-tris(2-methylbutan-2-yl)naphthalen-2-yl]cyclohexyl]-λ5-phosphane.
| Compound Name | trihydroxy-naphthalen-2-yl-[1-[3,6,8-tris(2-methylbutan-2-yl)naphthalen-2-yl]cyclohexyl]-λ5-phosphane |
|---|---|
| PubChem CID | 67788223 |
| Molecular Formula | C41H57O3P |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | trihydroxy-naphthalen-2-yl-[1-[3,6,8-tris(2-methylbutan-2-yl)naphthalen-2-yl]cyclohexyl]-λ5-phosphane |
| SMILES | CCC(C)(C)c1cc(C(C)(C)CC)c2cc(C3(P(O)(O)(O)c4ccc5ccccc5c4)CCCCC3)c(C(C)(C)CC)cc2c1 |
| InChI | InChI=1S/C41H57O3P/c1-10-38(4,5)32-24-31-26-36(40(8,9)12-3)37(28-34(31)35(27-32)39(6,7)11-2)41(22-16-13-17-23-41)45(42,43,44)33-21-20-29-18-14-15-19-30(29)25-33/h14-15,18-21,24-28,42-44H,10-13,16-17,22-23H2,1-9H3 |
| InChIKey | NKPLOWDCNAVKBD-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|