C36H68OSi — CID 67788441
tert-butyl-[(9R)-9-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyldecoxy]-dimethylsilane (PubChem CID 67788441) has the molecular formula C36H68OSi and a molecular weight of 545.03 g/mol. Its IUPAC name is tert-butyl-[(9R)-9-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyldecoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(9R)-9-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyldecoxy]-dimethylsilane |
|---|---|
| PubChem CID | 67788441 |
| Molecular Formula | C36H68OSi |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 544.50 |
| IUPAC Name | tert-butyl-[(9R)-9-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-methyldecoxy]-dimethylsilane |
| SMILES | CC(CCCCO[Si](C)(C)C(C)(C)C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H68OSi/c1-27(15-11-13-26-37-38(8,9)34(3,4)5)16-14-17-28(2)31-21-22-32-30-20-19-29-18-10-12-24-35(29,6)33(30)23-25-36(31,32)7/h27-33H,10-26H2,1-9H3/t27?,28-,29?,30+,31-,32+,33+,35+,36-/m1/s1 |
| InChIKey | YJUZXAPOAKPQGX-DYNBVCDYSA-N |
| XLogP | 11.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|