C13H16O4 — CID 67788544
(2Z)-3-prop-2-enoxycarbonyl-2-prop-2-enylhexa-2,5-dienoic acid (PubChem CID 67788544) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2Z)-3-prop-2-enoxycarbonyl-2-prop-2-enylhexa-2,5-dienoic acid.
| Compound Name | (2Z)-3-prop-2-enoxycarbonyl-2-prop-2-enylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 67788544 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (2Z)-3-prop-2-enoxycarbonyl-2-prop-2-enylhexa-2,5-dienoic acid |
| SMILES | C=CCOC(=O)/C(CC=C)=C(/CC=C)C(=O)O |
| InChI | InChI=1S/C13H16O4/c1-4-7-10(12(14)15)11(8-5-2)13(16)17-9-6-3/h4-6H,1-3,7-9H2,(H,14,15)/b11-10- |
| InChIKey | UORQVFCUZVEZHZ-KHPPLWFESA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|