C14H13NO — CID 67788631
3-cyclohexa-1,5-dien-1-yl-2H-1,4-benzoxazine (PubChem CID 67788631) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-2H-1,4-benzoxazine.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 67788631 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-2H-1,4-benzoxazine |
| SMILES | C1=CC(C2=Nc3ccccc3OC2)=CCC1 |
| InChI | InChI=1S/C14H13NO/c1-2-6-11(7-3-1)13-10-16-14-9-5-4-8-12(14)15-13/h2,4-9H,1,3,10H2 |
| InChIKey | QKVMAIKLGBXILW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |