About CID 67788703
CID 67788703 (PubChem CID 67788703) has the molecular formula C25H32NO8Si
and a molecular weight of 502.62 g/mol.
Molecular Properties
| Compound Name | CID 67788703 |
| PubChem CID | 67788703 |
| Molecular Formula | C25H32NO8Si |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)[C@@H]([C@@H]1[C@H]([C@@H](CO[Si](C)C)C(C)(C)C)C(=O)N1C(=O)C(=O)O)CC2 |
| InChI | InChI=1S/C25H32NO8Si/c1-25(2,3)17(12-34-35(5)6)18-19(26(21(18)28)22(29)23(30)31)15-10-9-13-7-8-14(24(32)33-4)11-16(13)20(15)27/h7-8,11,15,17-19H,9-10,12H2,1-6H3,(H,30,31)/t15-,17-,18+,19-/m1/s1 |
| InChIKey | ONECELSYFXVKRH-OQIJWPOYSA-N |
| XLogP | 2.59 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67788703 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67788703?
The IUPAC name of CID 67788703 (CID 67788703) is not available.
What is the SMILES notation for CID 67788703?
The canonical SMILES for CID 67788703 is COC(=O)c1ccc2c(c1)C(=O)[C@@H]([C@@H]1[C@H]([C@@H](CO[Si](C)C)C(C)(C)C)C(=O)N1C(=O)C(=O)O)CC2.
What is the InChIKey of CID 67788703?
The InChIKey is ONECELSYFXVKRH-OQIJWPOYSA-N. The full InChI is InChI=1S/C25H32NO8Si/c1-25(2,3)17(12-34-35(5)6)18-19(26(21(18)28)22(29)23(30)31)15-10-9-13-7-8-14(24(32)33-4)11-16(13)20(15)27/h7-8,11,15,17-19H,9-10,12H2,1-6H3,(H,30,31)/t15-,17-,18+,19-/m1/s1.
What are the key properties of CID 67788703?
CID 67788703 has a molecular weight of 502.62 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67788703 is sourced from PubChem (CID 67788703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).