C25H30O6 — CID 67788779
3-[4,4-bis(oxan-2-yloxy)cyclohexa-1,5-dien-1-yl]-1-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 67788779) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-[4,4-bis(oxan-2-yloxy)cyclohexa-1,5-dien-1-yl]-1-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[4,4-bis(oxan-2-yloxy)cyclohexa-1,5-dien-1-yl]-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67788779 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-[4,4-bis(oxan-2-yloxy)cyclohexa-1,5-dien-1-yl]-1-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(C=CC1=CCC(OC2CCCCO2)(OC2CCCCO2)C=C1)c1ccccc1O |
| InChI | InChI=1S/C25H30O6/c26-21-8-2-1-7-20(21)22(27)12-11-19-13-15-25(16-14-19,30-23-9-3-5-17-28-23)31-24-10-4-6-18-29-24/h1-2,7-8,11-15,23-24,26H,3-6,9-10,16-18H2 |
| InChIKey | GCNDJRHKCZZTMV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|