About bis(4,4-dimethylmorpholin-4-ium);sulfide
bis(4,4-dimethylmorpholin-4-ium);sulfide (PubChem CID 67788845) has the molecular formula C12H28N2O2S
and a molecular weight of 264.43 g/mol. Its IUPAC name is bis(4,4-dimethylmorpholin-4-ium);sulfide.
Molecular Properties
| Compound Name | bis(4,4-dimethylmorpholin-4-ium);sulfide |
| PubChem CID | 67788845 |
| Molecular Formula | C12H28N2O2S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | bis(4,4-dimethylmorpholin-4-ium);sulfide |
| SMILES | C[N+]1(C)CCOCC1.C[N+]1(C)CCOCC1.[S-2] |
| InChI | InChI=1S/2C6H14NO.S/c2*1-7(2)3-5-8-6-4-7;/h2*3-6H2,1-2H3;/q2*+1;-2 |
| InChIKey | FKAIWVUBCGLSIS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4,4-dimethylmorpholin-4-ium);sulfide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,4-dimethylmorpholin-4-ium);sulfide?
The IUPAC name of bis(4,4-dimethylmorpholin-4-ium);sulfide (CID 67788845) is bis(4,4-dimethylmorpholin-4-ium);sulfide.
What is the SMILES notation for bis(4,4-dimethylmorpholin-4-ium);sulfide?
The canonical SMILES for bis(4,4-dimethylmorpholin-4-ium);sulfide is C[N+]1(C)CCOCC1.C[N+]1(C)CCOCC1.[S-2].
What is the InChIKey of bis(4,4-dimethylmorpholin-4-ium);sulfide?
The InChIKey is FKAIWVUBCGLSIS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14NO.S/c2*1-7(2)3-5-8-6-4-7;/h2*3-6H2,1-2H3;/q2*+1;-2.
What are the key properties of bis(4,4-dimethylmorpholin-4-ium);sulfide?
bis(4,4-dimethylmorpholin-4-ium);sulfide has a molecular weight of 264.43 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,4-dimethylmorpholin-4-ium);sulfide is sourced from PubChem (CID 67788845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).