About N-(1-aminohexyl)acetamide;azane;benzene
N-(1-aminohexyl)acetamide;azane;benzene (PubChem CID 67788948) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(1-aminohexyl)acetamide;azane;benzene.
Molecular Properties
| Compound Name | N-(1-aminohexyl)acetamide;azane;benzene |
| PubChem CID | 67788948 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-(1-aminohexyl)acetamide;azane;benzene |
| SMILES | CCCCCC(N)NC(C)=O.N.c1ccccc1 |
| InChI | InChI=1S/C8H18N2O.C6H6.H3N/c1-3-4-5-6-8(9)10-7(2)11;1-2-4-6-5-3-1;/h8H,3-6,9H2,1-2H3,(H,10,11);1-6H;1H3 |
| InChIKey | HZADUNDYKMNASM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-aminohexyl)acetamide;azane;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminohexyl)acetamide;azane;benzene?
The IUPAC name of N-(1-aminohexyl)acetamide;azane;benzene (CID 67788948) is N-(1-aminohexyl)acetamide;azane;benzene.
What is the SMILES notation for N-(1-aminohexyl)acetamide;azane;benzene?
The canonical SMILES for N-(1-aminohexyl)acetamide;azane;benzene is CCCCCC(N)NC(C)=O.N.c1ccccc1.
What is the InChIKey of N-(1-aminohexyl)acetamide;azane;benzene?
The InChIKey is HZADUNDYKMNASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.C6H6.H3N/c1-3-4-5-6-8(9)10-7(2)11;1-2-4-6-5-3-1;/h8H,3-6,9H2,1-2H3,(H,10,11);1-6H;1H3.
What are the key properties of N-(1-aminohexyl)acetamide;azane;benzene?
N-(1-aminohexyl)acetamide;azane;benzene has a molecular weight of 253.39 g/mol, XLogP of 2.84, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminohexyl)acetamide;azane;benzene is sourced from PubChem (CID 67788948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).