About 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane
3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane (PubChem CID 67789044) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane.
Molecular Properties
| Compound Name | 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane |
| PubChem CID | 67789044 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane |
| SMILES | C=CCCC/C=C/COCC1(CC)COC1 |
| InChI | InChI=1S/C14H24O2/c1-3-5-6-7-8-9-10-15-11-14(4-2)12-16-13-14/h3,8-9H,1,4-7,10-13H2,2H3/b9-8+ |
| InChIKey | VZQMGAFSHJIREW-CMDGGOBGSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane?
The IUPAC name of 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane (CID 67789044) is 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane.
What is the SMILES notation for 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane?
The canonical SMILES for 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane is C=CCCC/C=C/COCC1(CC)COC1.
What is the InChIKey of 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane?
The InChIKey is VZQMGAFSHJIREW-CMDGGOBGSA-N. The full InChI is InChI=1S/C14H24O2/c1-3-5-6-7-8-9-10-15-11-14(4-2)12-16-13-14/h3,8-9H,1,4-7,10-13H2,2H3/b9-8+.
What are the key properties of 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane?
3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane has a molecular weight of 224.34 g/mol, XLogP of 3.34, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-[[(2E)-octa-2,7-dienoxy]methyl]oxetane is sourced from PubChem (CID 67789044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).