C28H34O3 — CID 67789045
(8R,9S,10R,11S,13S,14S)-11-(4-ethenylphenyl)-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (PubChem CID 67789045) has the molecular formula C28H34O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is (8R,9S,10R,11S,13S,14S)-11-(4-ethenylphenyl)-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one.
| Compound Name | (8R,9S,10R,11S,13S,14S)-11-(4-ethenylphenyl)-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|---|
| PubChem CID | 67789045 |
| Molecular Formula | C28H34O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (8R,9S,10R,11S,13S,14S)-11-(4-ethenylphenyl)-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| SMILES | C=Cc1ccc([C@H]2C[C@]3(C)C(=O)CC[C@H]3[C@@H]3CC=C4CC5(CC[C@@H]4[C@H]32)OCCO5)cc1 |
| InChI | InChI=1S/C28H34O3/c1-3-18-4-6-19(7-5-18)23-17-27(2)24(10-11-25(27)29)22-9-8-20-16-28(30-14-15-31-28)13-12-21(20)26(22)23/h3-8,21-24,26H,1,9-17H2,2H3/t21-,22-,23+,24-,26+,27-/m0/s1 |
| InChIKey | STEOWAXVPNLKET-KFAAIOHLSA-N |
| XLogP | 5.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|