C21H40O3S — CID 67789132
(3aR,6R,6aR)-4-dodecan-5-ylsulfanyl-2,2,4,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole (PubChem CID 67789132) has the molecular formula C21H40O3S and a molecular weight of 372.62 g/mol. Its IUPAC name is (3aR,6R,6aR)-4-dodecan-5-ylsulfanyl-2,2,4,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole.
| Compound Name | (3aR,6R,6aR)-4-dodecan-5-ylsulfanyl-2,2,4,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 67789132 |
| Molecular Formula | C21H40O3S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (3aR,6R,6aR)-4-dodecan-5-ylsulfanyl-2,2,4,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
| SMILES | CCCCCCCC(CCCC)SC1(C)O[C@H](C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H40O3S/c1-7-9-11-12-13-15-17(14-10-8-2)25-21(6)19-18(16(3)22-21)23-20(4,5)24-19/h16-19H,7-15H2,1-6H3/t16-,17?,18-,19-,21?/m1/s1 |
| InChIKey | ZDYLKCRNQOHAOZ-SKZNFHJNSA-N |
| XLogP | 6.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|