C17H14FN3O4 — CID 67789230
5-(5-acetyl-3-but-2-enyl-2,4,6-trioxo-1,3-diazinan-1-yl)-2-fluorobenzonitrile (PubChem CID 67789230) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is 5-(5-acetyl-3-but-2-enyl-2,4,6-trioxo-1,3-diazinan-1-yl)-2-fluorobenzonitrile.
| Compound Name | 5-(5-acetyl-3-but-2-enyl-2,4,6-trioxo-1,3-diazinan-1-yl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 67789230 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-(5-acetyl-3-but-2-enyl-2,4,6-trioxo-1,3-diazinan-1-yl)-2-fluorobenzonitrile |
| SMILES | CC=CCN1C(=O)C(C(C)=O)C(=O)N(c2ccc(F)c(C#N)c2)C1=O |
| InChI | InChI=1S/C17H14FN3O4/c1-3-4-7-20-15(23)14(10(2)22)16(24)21(17(20)25)12-5-6-13(18)11(8-12)9-19/h3-6,8,14H,7H2,1-2H3 |
| InChIKey | ORXICPAUUBPXRH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|