C11H16O4 — CID 67789284
4-but-2-enoyloxycyclohexane-1-carboxylic acid (PubChem CID 67789284) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-but-2-enoyloxycyclohexane-1-carboxylic acid.
| Compound Name | 4-but-2-enoyloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67789284 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-but-2-enoyloxycyclohexane-1-carboxylic acid |
| SMILES | CC=CC(=O)OC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H16O4/c1-2-3-10(12)15-9-6-4-8(5-7-9)11(13)14/h2-3,8-9H,4-7H2,1H3,(H,13,14) |
| InChIKey | VGPYDKFXRVWXFM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|