About (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane
(3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane (PubChem CID 67789294) has the molecular formula C22H36O6S
and a molecular weight of 428.59 g/mol. Its IUPAC name is (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane.
Molecular Properties
| Compound Name | (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane |
| PubChem CID | 67789294 |
| Molecular Formula | C22H36O6S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane |
| SMILES | C1CCC(OC2CCCCO2)OC1.C[C@@H](CS(=O)(=O)c1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C12H18O3S.C10H18O3/c1-10(12(2,3)13)9-16(14,15)11-7-5-4-6-8-11;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h4-8,10,13H,9H2,1-3H3;9-10H,1-8H2/t10-;/m0./s1 |
| InChIKey | OIUIMLCEJGCNOM-PPHPATTJSA-N |
| XLogP | 3.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane?
The IUPAC name of (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane (CID 67789294) is (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane.
What is the SMILES notation for (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane?
The canonical SMILES for (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane is C1CCC(OC2CCCCO2)OC1.C[C@@H](CS(=O)(=O)c1ccccc1)C(C)(C)O.
What is the InChIKey of (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane?
The InChIKey is OIUIMLCEJGCNOM-PPHPATTJSA-N. The full InChI is InChI=1S/C12H18O3S.C10H18O3/c1-10(12(2,3)13)9-16(14,15)11-7-5-4-6-8-11;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h4-8,10,13H,9H2,1-3H3;9-10H,1-8H2/t10-;/m0./s1.
What are the key properties of (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane?
(3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane has a molecular weight of 428.59 g/mol, XLogP of 3.92, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-ol;2-(oxan-2-yloxy)oxane is sourced from PubChem (CID 67789294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).