C10H16N2O3S — CID 67790048
1-[(4-methylphenyl)sulfonylmethoxy]ethane-1,2-diamine (PubChem CID 67790048) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-[(4-methylphenyl)sulfonylmethoxy]ethane-1,2-diamine.
| Compound Name | 1-[(4-methylphenyl)sulfonylmethoxy]ethane-1,2-diamine |
|---|---|
| PubChem CID | 67790048 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-[(4-methylphenyl)sulfonylmethoxy]ethane-1,2-diamine |
| SMILES | Cc1ccc(S(=O)(=O)COC(N)CN)cc1 |
| InChI | InChI=1S/C10H16N2O3S/c1-8-2-4-9(5-3-8)16(13,14)7-15-10(12)6-11/h2-5,10H,6-7,11-12H2,1H3 |
| InChIKey | MDPHNIRZSRYKGH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|