C32H62O3Si2 — CID 67790066
5-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol (PubChem CID 67790066) has the molecular formula C32H62O3Si2 and a molecular weight of 551.02 g/mol. Its IUPAC name is 5-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol.
| Compound Name | 5-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 67790066 |
| Molecular Formula | C32H62O3Si2 |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | 5-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-en-1-ol |
| SMILES | CC=C(CCCCO)[C@@H]1CC=C(/C=C/CCCCCCO[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H62O3Si2/c1-12-27(21-18-19-25-33)29-24-23-28(30(29)35-37(10,11)32(5,6)7)22-17-15-13-14-16-20-26-34-36(8,9)31(2,3)4/h12,17,22-23,29-30,33H,13-16,18-21,24-26H2,1-11H3/b22-17+,27-12?/t29-,30+/m0/s1 |
| InChIKey | VHJMYKQFVPHGFN-RWGCDZNRSA-N |
| XLogP | 9.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|