About 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline
2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline (PubChem CID 67790068) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline |
| PubChem CID | 67790068 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline |
| SMILES | C1=CNCC1.C1=Cc2ccccc2NC1 |
| InChI | InChI=1S/C9H9N.C4H7N/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-5-3-1/h1-6,10H,7H2;1,3,5H,2,4H2 |
| InChIKey | OPQATIKRVDZWCW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline?
The IUPAC name of 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline (CID 67790068) is 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline.
What is the SMILES notation for 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline?
The canonical SMILES for 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline is C1=CNCC1.C1=Cc2ccccc2NC1.
What is the InChIKey of 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline?
The InChIKey is OPQATIKRVDZWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C4H7N/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-5-3-1/h1-6,10H,7H2;1,3,5H,2,4H2.
What are the key properties of 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline?
2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline has a molecular weight of 200.29 g/mol, XLogP of 2.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrrole;1,2-dihydroquinoline is sourced from PubChem (CID 67790068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).