About 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol
1-(pentylamino)cyclohexa-3,5-diene-1,3-diol (PubChem CID 67790387) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol.
Molecular Properties
| Compound Name | 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol |
| PubChem CID | 67790387 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol |
| SMILES | CCCCCNC1(O)C=CC=C(O)C1 |
| InChI | InChI=1S/C11H19NO2/c1-2-3-4-8-12-11(14)7-5-6-10(13)9-11/h5-7,12-14H,2-4,8-9H2,1H3 |
| InChIKey | AOUZMZILMQELOJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol?
The IUPAC name of 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol (CID 67790387) is 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol.
What is the SMILES notation for 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol?
The canonical SMILES for 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol is CCCCCNC1(O)C=CC=C(O)C1.
What is the InChIKey of 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol?
The InChIKey is AOUZMZILMQELOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-2-3-4-8-12-11(14)7-5-6-10(13)9-11/h5-7,12-14H,2-4,8-9H2,1H3.
What are the key properties of 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol?
1-(pentylamino)cyclohexa-3,5-diene-1,3-diol has a molecular weight of 197.28 g/mol, XLogP of 1.86, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pentylamino)cyclohexa-3,5-diene-1,3-diol is sourced from PubChem (CID 67790387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).