C27H35N3O3 — CID 67790928
(2S)-2-[[(3S)-4-[(4-aminophenyl)methyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]amino]-4-cyclohexylbutanoic acid (PubChem CID 67790928) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is (2S)-2-[[(3S)-4-[(4-aminophenyl)methyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]amino]-4-cyclohexylbutanoic acid.
| Compound Name | (2S)-2-[[(3S)-4-[(4-aminophenyl)methyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]amino]-4-cyclohexylbutanoic acid |
|---|---|
| PubChem CID | 67790928 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (2S)-2-[[(3S)-4-[(4-aminophenyl)methyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]amino]-4-cyclohexylbutanoic acid |
| SMILES | Nc1ccc(CC2Cc3ccccc3NC(=O)[C@@H]2N[C@@H](CCC2CCCCC2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H35N3O3/c28-22-13-10-19(11-14-22)16-21-17-20-8-4-5-9-23(20)30-26(31)25(21)29-24(27(32)33)15-12-18-6-2-1-3-7-18/h4-5,8-11,13-14,18,21,24-25,29H,1-3,6-7,12,15-17,28H2,(H,30,31)(H,32,33)/t21?,24-,25+/m0/s1 |
| InChIKey | QJLJGCWQRSVCKR-DYCCLRLQSA-N |
| XLogP | 4.39 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|