C18H26N2O5 — CID 67792283
prop-2-enyl (2R)-2-[(E)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 67792283) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-[(E)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R)-2-[(E)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67792283 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | prop-2-enyl (2R)-2-[(E)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@@H]1/C=C(\C)C(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O |
| InChI | InChI=1S/C18H26N2O5/c1-4-8-25-18(24)20-7-5-6-13(20)9-11(2)15(22)10-14-16(12(3)21)17(23)19-14/h4,9,12-14,16,21H,1,5-8,10H2,2-3H3,(H,19,23)/b11-9+/t12-,13-,14-,16-/m1/s1 |
| InChIKey | LNQYJTSUPZHNFJ-MDKUFCHSSA-N |
| XLogP | 1.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|