About 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid
3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid (PubChem CID 67792312) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid.
Molecular Properties
| Compound Name | 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid |
| PubChem CID | 67792312 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid |
| SMILES | C=C1C=C(OCCC(=O)O)C(C(C)(C)C)=CC1 |
| InChI | InChI=1S/C14H20O3/c1-10-5-6-11(14(2,3)4)12(9-10)17-8-7-13(15)16/h6,9H,1,5,7-8H2,2-4H3,(H,15,16) |
| InChIKey | BIAMFTDICBLFBW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid?
The IUPAC name of 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid (CID 67792312) is 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid.
What is the SMILES notation for 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid?
The canonical SMILES for 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid is C=C1C=C(OCCC(=O)O)C(C(C)(C)C)=CC1.
What is the InChIKey of 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid?
The InChIKey is BIAMFTDICBLFBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-10-5-6-11(14(2,3)4)12(9-10)17-8-7-13(15)16/h6,9H,1,5,7-8H2,2-4H3,(H,15,16).
What are the key properties of 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid?
3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid has a molecular weight of 236.31 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-tert-butyl-3-methylidenecyclohexa-1,5-dien-1-yl)oxypropanoic acid is sourced from PubChem (CID 67792312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).