C15H21NO6S2 — CID 67792343
(3S,4R)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2,2-dimethyl-6-methylsulfonyl-3,4-dihydrochromen-3-ol (PubChem CID 67792343) has the molecular formula C15H21NO6S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (3S,4R)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2,2-dimethyl-6-methylsulfonyl-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2,2-dimethyl-6-methylsulfonyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 67792343 |
| Molecular Formula | C15H21NO6S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (3S,4R)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2,2-dimethyl-6-methylsulfonyl-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2ccc(S(C)(=O)=O)cc2[C@@H](N2CCCS2(=O)=O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO6S2/c1-15(2)14(17)13(16-7-4-8-24(16,20)21)11-9-10(23(3,18)19)5-6-12(11)22-15/h5-6,9,13-14,17H,4,7-8H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | CQUATEUIRPLBHZ-KGLIPLIRSA-N |
| XLogP | 0.70 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |