C32H56O4Si — CID 67793287
(4R,6R)-6-[2-[(1S,2R,8S,8aR)-2-methyl-8-(2-propylpentoxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one (PubChem CID 67793287) has the molecular formula C32H56O4Si and a molecular weight of 532.88 g/mol. Its IUPAC name is (4R,6R)-6-[2-[(1S,2R,8S,8aR)-2-methyl-8-(2-propylpentoxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one.
| Compound Name | (4R,6R)-6-[2-[(1S,2R,8S,8aR)-2-methyl-8-(2-propylpentoxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
|---|---|
| PubChem CID | 67793287 |
| Molecular Formula | C32H56O4Si |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | (4R,6R)-6-[2-[(1S,2R,8S,8aR)-2-methyl-8-(2-propylpentoxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
| SMILES | CCCC(CCC)CO[C@H]1CCC=C2C=C[C@@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C32H56O4Si/c1-9-12-24(13-10-2)22-34-29-15-11-14-25-17-16-23(3)28(31(25)29)19-18-26-20-27(21-30(33)35-26)36-37(7,8)32(4,5)6/h14,16-17,23-24,26-29,31H,9-13,15,18-22H2,1-8H3/t23-,26-,27-,28+,29+,31+/m1/s1 |
| InChIKey | WEBJAUIITHYRDR-JREXFKCGSA-N |
| XLogP | 8.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|