About 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine
2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine (PubChem CID 67793364) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine |
| PubChem CID | 67793364 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCC1(C)N=c2ccc(C)nc2=N1 |
| InChI | InChI=1S/C10H13N3/c1-4-10(3)12-8-6-5-7(2)11-9(8)13-10/h5-6H,4H2,1-3H3 |
| InChIKey | UYVPSEXSJAOSEW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine?
The IUPAC name of 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine (CID 67793364) is 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine.
What is the SMILES notation for 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine?
The canonical SMILES for 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine is CCC1(C)N=c2ccc(C)nc2=N1.
What is the InChIKey of 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine?
The InChIKey is UYVPSEXSJAOSEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-4-10(3)12-8-6-5-7(2)11-9(8)13-10/h5-6H,4H2,1-3H3.
What are the key properties of 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine?
2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine has a molecular weight of 175.23 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,5-dimethylimidazo[4,5-b]pyridine is sourced from PubChem (CID 67793364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).