C36H48N6O6S — CID 67793449
benzyl N-[[4-[[[(2R)-2,5-diaminopentanoyl]-[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]methyl]phenyl]methyl]carbamate (PubChem CID 67793449) has the molecular formula C36H48N6O6S and a molecular weight of 692.88 g/mol. Its IUPAC name is benzyl N-[[4-[[[(2R)-2,5-diaminopentanoyl]-[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]methyl]phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[[[(2R)-2,5-diaminopentanoyl]-[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67793449 |
| Molecular Formula | C36H48N6O6S |
| Molecular Weight | 692.88 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | benzyl N-[[4-[[[(2R)-2,5-diaminopentanoyl]-[N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidoyl]amino]methyl]phenyl]methyl]carbamate |
| SMILES | Cc1c(C)c(S(=O)(=O)N=C(N)N(Cc2ccc(CNC(=O)OCc3ccccc3)cc2)C(=O)[C@H](N)CCCN)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C36H48N6O6S/c1-23-24(2)32(25(3)29-17-18-36(4,5)48-31(23)29)49(45,46)41-34(39)42(33(43)30(38)12-9-19-37)21-27-15-13-26(14-16-27)20-40-35(44)47-22-28-10-7-6-8-11-28/h6-8,10-11,13-16,30H,9,12,17-22,37-38H2,1-5H3,(H2,39,41)(H,40,44)/t30-/m1/s1 |
| InChIKey | PAJRUJKAEYSZAY-SSEXGKCCSA-N |
| XLogP | 4.24 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|