C21H25N3O4 — CID 67793475
(3R,4R)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylic acid (PubChem CID 67793475) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3R,4R)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67793475 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3R,4R)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCN1C[C@@H](C(=O)O)[C@@H](NC(=O)Nc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C21H25N3O4/c1-2-3-6-11-24-13-17(20(26)27)18(19(24)25)23-21(28)22-16-10-9-14-7-4-5-8-15(14)12-16/h4-5,7-10,12,17-18H,2-3,6,11,13H2,1H3,(H,26,27)(H2,22,23,28)/t17-,18-/m1/s1 |
| InChIKey | JLOGJEPBQJABAK-QZTJIDSGSA-N |
| XLogP | 3.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|