C15H20N4O4S — CID 67793888
9-ethyl-N,N-dimethyl-2,3-dioxo-4,7,8,10-tetrahydropyrido[4,3-h]quinoxaline-1-sulfonamide (PubChem CID 67793888) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is 9-ethyl-N,N-dimethyl-2,3-dioxo-4,7,8,10-tetrahydropyrido[4,3-h]quinoxaline-1-sulfonamide.
| Compound Name | 9-ethyl-N,N-dimethyl-2,3-dioxo-4,7,8,10-tetrahydropyrido[4,3-h]quinoxaline-1-sulfonamide |
|---|---|
| PubChem CID | 67793888 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 9-ethyl-N,N-dimethyl-2,3-dioxo-4,7,8,10-tetrahydropyrido[4,3-h]quinoxaline-1-sulfonamide |
| SMILES | CCN1CCc2ccc3[nH]c(=O)c(=O)n(S(=O)(=O)N(C)C)c3c2C1 |
| InChI | InChI=1S/C15H20N4O4S/c1-4-18-8-7-10-5-6-12-13(11(10)9-18)19(15(21)14(20)16-12)24(22,23)17(2)3/h5-6H,4,7-9H2,1-3H3,(H,16,20) |
| InChIKey | SCOLDLWOHBGHFU-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|