About 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate
2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate (PubChem CID 67794030) has the molecular formula C16H16N4O2S
and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate.
Molecular Properties
| Compound Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate |
| PubChem CID | 67794030 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate |
| SMILES | CN(C(=O)OCCSc1cccc2nccn12)c1ccncc1 |
| InChI | InChI=1S/C16H16N4O2S/c1-19(13-5-7-17-8-6-13)16(21)22-11-12-23-15-4-2-3-14-18-9-10-20(14)15/h2-10H,11-12H2,1H3 |
| InChIKey | OXFFTLUBCOIBRU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate?
The IUPAC name of 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate (CID 67794030) is 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate.
What is the SMILES notation for 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate?
The canonical SMILES for 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate is CN(C(=O)OCCSc1cccc2nccn12)c1ccncc1.
What is the InChIKey of 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate?
The InChIKey is OXFFTLUBCOIBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2S/c1-19(13-5-7-17-8-6-13)16(21)22-11-12-23-15-4-2-3-14-18-9-10-20(14)15/h2-10H,11-12H2,1H3.
What are the key properties of 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate?
2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate has a molecular weight of 328.40 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-methyl-N-pyridin-4-ylcarbamate is sourced from PubChem (CID 67794030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).