C27H34N4O3 — CID 67794082
bis[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] carbonate (PubChem CID 67794082) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is bis[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] carbonate.
| Compound Name | bis[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] carbonate |
|---|---|
| PubChem CID | 67794082 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | bis[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] carbonate |
| SMILES | CN1CC[C@@]2(C)c3cc(OC(=O)Oc4ccc5c(c4)[C@]4(C)CCN(C)[C@@H]4N5C)ccc3N(C)[C@@H]12 |
| InChI | InChI=1S/C27H34N4O3/c1-26-11-13-28(3)23(26)30(5)21-9-7-17(15-19(21)26)33-25(32)34-18-8-10-22-20(16-18)27(2)12-14-29(4)24(27)31(22)6/h7-10,15-16,23-24H,11-14H2,1-6H3/t23-,24-,26+,27+/m1/s1 |
| InChIKey | NHGVWVBESKFVCA-KAHCWPQKSA-N |
| XLogP | 4.00 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|