About 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol
6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol (PubChem CID 67794204) has the molecular formula C13H17F3O2S
and a molecular weight of 294.34 g/mol. Its IUPAC name is 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol.
Molecular Properties
| Compound Name | 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol |
| PubChem CID | 67794204 |
| Molecular Formula | C13H17F3O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol |
| SMILES | CC(O)CC(O)CCc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3O2S/c1-9(17)8-11(18)5-2-10-3-6-12(7-4-10)19-13(14,15)16/h3-4,6-7,9,11,17-18H,2,5,8H2,1H3 |
| InChIKey | RQCUDMVBQSRGQQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol?
The IUPAC name of 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol (CID 67794204) is 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol.
What is the SMILES notation for 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol?
The canonical SMILES for 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol is CC(O)CC(O)CCc1ccc(SC(F)(F)F)cc1.
What is the InChIKey of 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol?
The InChIKey is RQCUDMVBQSRGQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3O2S/c1-9(17)8-11(18)5-2-10-3-6-12(7-4-10)19-13(14,15)16/h3-4,6-7,9,11,17-18H,2,5,8H2,1H3.
What are the key properties of 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol?
6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol has a molecular weight of 294.34 g/mol, XLogP of 3.36, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(trifluoromethylsulfanyl)phenyl]hexane-2,4-diol is sourced from PubChem (CID 67794204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).