C33H38N2O3 — CID 67794237
3,3-dimethyl-2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]butanoic acid (PubChem CID 67794237) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is 3,3-dimethyl-2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]butanoic acid |
|---|---|
| PubChem CID | 67794237 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 3,3-dimethyl-2-[6-(3,4,5-triphenylpyrazol-1-yl)hexoxy]butanoic acid |
| SMILES | CC(C)(C)C(OCCCCCCn1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H38N2O3/c1-33(2,3)31(32(36)37)38-24-16-5-4-15-23-35-30(27-21-13-8-14-22-27)28(25-17-9-6-10-18-25)29(34-35)26-19-11-7-12-20-26/h6-14,17-22,31H,4-5,15-16,23-24H2,1-3H3,(H,36,37) |
| InChIKey | TUVSSLUBHOUAPY-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|