C17H25NO2 — CID 67794881
2-cyano-6-(2,4,6,6-tetramethylcyclohexen-1-yl)hex-2-enoic acid (PubChem CID 67794881) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-cyano-6-(2,4,6,6-tetramethylcyclohexen-1-yl)hex-2-enoic acid.
| Compound Name | 2-cyano-6-(2,4,6,6-tetramethylcyclohexen-1-yl)hex-2-enoic acid |
|---|---|
| PubChem CID | 67794881 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-cyano-6-(2,4,6,6-tetramethylcyclohexen-1-yl)hex-2-enoic acid |
| SMILES | CC1=C(CCCC=C(C#N)C(=O)O)C(C)(C)CC(C)C1 |
| InChI | InChI=1S/C17H25NO2/c1-12-9-13(2)15(17(3,4)10-12)8-6-5-7-14(11-18)16(19)20/h7,12H,5-6,8-10H2,1-4H3,(H,19,20) |
| InChIKey | ASIHEGGZUUDJMI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|