About 4-propan-2-ylpyridine-2,3-dicarboxamide
4-propan-2-ylpyridine-2,3-dicarboxamide (PubChem CID 67794907) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-propan-2-ylpyridine-2,3-dicarboxamide.
Molecular Properties
| Compound Name | 4-propan-2-ylpyridine-2,3-dicarboxamide |
| PubChem CID | 67794907 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-propan-2-ylpyridine-2,3-dicarboxamide |
| SMILES | CC(C)c1ccnc(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C10H13N3O2/c1-5(2)6-3-4-13-8(10(12)15)7(6)9(11)14/h3-5H,1-2H3,(H2,11,14)(H2,12,15) |
| InChIKey | VHZFJGYGKBXVAT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-ylpyridine-2,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylpyridine-2,3-dicarboxamide?
The IUPAC name of 4-propan-2-ylpyridine-2,3-dicarboxamide (CID 67794907) is 4-propan-2-ylpyridine-2,3-dicarboxamide.
What is the SMILES notation for 4-propan-2-ylpyridine-2,3-dicarboxamide?
The canonical SMILES for 4-propan-2-ylpyridine-2,3-dicarboxamide is CC(C)c1ccnc(C(N)=O)c1C(N)=O.
What is the InChIKey of 4-propan-2-ylpyridine-2,3-dicarboxamide?
The InChIKey is VHZFJGYGKBXVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-5(2)6-3-4-13-8(10(12)15)7(6)9(11)14/h3-5H,1-2H3,(H2,11,14)(H2,12,15).
What are the key properties of 4-propan-2-ylpyridine-2,3-dicarboxamide?
4-propan-2-ylpyridine-2,3-dicarboxamide has a molecular weight of 207.23 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylpyridine-2,3-dicarboxamide is sourced from PubChem (CID 67794907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).