About naphthalen-1-ol;pyridazine
naphthalen-1-ol;pyridazine (PubChem CID 67795055) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is naphthalen-1-ol;pyridazine.
Molecular Properties
| Compound Name | naphthalen-1-ol;pyridazine |
| PubChem CID | 67795055 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | naphthalen-1-ol;pyridazine |
| SMILES | Oc1cccc2ccccc12.c1ccnnc1 |
| InChI | InChI=1S/C10H8O.C4H4N2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-4-6-5-3-1/h1-7,11H;1-4H |
| InChIKey | BIXGCNSIMMLZIR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalen-1-ol;pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ol;pyridazine?
The IUPAC name of naphthalen-1-ol;pyridazine (CID 67795055) is naphthalen-1-ol;pyridazine.
What is the SMILES notation for naphthalen-1-ol;pyridazine?
The canonical SMILES for naphthalen-1-ol;pyridazine is Oc1cccc2ccccc12.c1ccnnc1.
What is the InChIKey of naphthalen-1-ol;pyridazine?
The InChIKey is BIXGCNSIMMLZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C4H4N2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-4-6-5-3-1/h1-7,11H;1-4H.
What are the key properties of naphthalen-1-ol;pyridazine?
naphthalen-1-ol;pyridazine has a molecular weight of 224.26 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ol;pyridazine is sourced from PubChem (CID 67795055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).