C15H13Cl2NO — CID 677956
3,4-dichloro-N-(3,4-dimethylphenyl)benzamide (PubChem CID 677956) has the molecular formula C15H13Cl2NO and a molecular weight of 294.18 g/mol. Its IUPAC name is 3,4-dichloro-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 3,4-dichloro-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 677956 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3,4-dichloro-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C15H13Cl2NO/c1-9-3-5-12(7-10(9)2)18-15(19)11-4-6-13(16)14(17)8-11/h3-8H,1-2H3,(H,18,19) |
| InChIKey | VUXKCSFPYSJYQA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |