C11H18N2O5S3 — CID 67795852
4-(1-methoxyethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 67795852) has the molecular formula C11H18N2O5S3 and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-(1-methoxyethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 4-(1-methoxyethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 67795852 |
| Molecular Formula | C11H18N2O5S3 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-(1-methoxyethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | COC(C)NC1CC(C)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C11H18N2O5S3/c1-6-4-9(13-7(2)18-3)8-5-10(21(12,16)17)19-11(8)20(6,14)15/h5-7,9,13H,4H2,1-3H3,(H2,12,16,17) |
| InChIKey | HSNXONQUVFMHDA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|