C15H25N3 — CID 67795889
(4aR,8aR)-3-tert-butyl-6-methyl-1,4,4a,5,7,8,8a,9-octahydropyrazolo[5,4-g]isoquinoline (PubChem CID 67795889) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (4aR,8aR)-3-tert-butyl-6-methyl-1,4,4a,5,7,8,8a,9-octahydropyrazolo[5,4-g]isoquinoline.
| Compound Name | (4aR,8aR)-3-tert-butyl-6-methyl-1,4,4a,5,7,8,8a,9-octahydropyrazolo[5,4-g]isoquinoline |
|---|---|
| PubChem CID | 67795889 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (4aR,8aR)-3-tert-butyl-6-methyl-1,4,4a,5,7,8,8a,9-octahydropyrazolo[5,4-g]isoquinoline |
| SMILES | CN1CC[C@@H]2Cc3[nH]nc(C(C)(C)C)c3C[C@H]2C1 |
| InChI | InChI=1S/C15H25N3/c1-15(2,3)14-12-7-11-9-18(4)6-5-10(11)8-13(12)16-17-14/h10-11H,5-9H2,1-4H3,(H,16,17)/t10-,11+/m1/s1 |
| InChIKey | QYKAMEXCPVLZKF-MNOVXSKESA-N |
| XLogP | 2.37 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |