C24H44N2O6 — CID 67796088
5-(2-propan-2-ylhexanoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid (PubChem CID 67796088) has the molecular formula C24H44N2O6 and a molecular weight of 456.62 g/mol. Its IUPAC name is 5-(2-propan-2-ylhexanoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 5-(2-propan-2-ylhexanoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 67796088 |
| Molecular Formula | C24H44N2O6 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 5-(2-propan-2-ylhexanoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCCCC(C(=O)NCCCC(CNC(=O)C1OC(C)(C)OCC1(C)C)C(=O)O)C(C)C |
| InChI | InChI=1S/C24H44N2O6/c1-8-9-12-18(16(2)3)20(27)25-13-10-11-17(22(29)30)14-26-21(28)19-23(4,5)15-31-24(6,7)32-19/h16-19H,8-15H2,1-7H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | UNHABHSRPZHBPS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|