C22H30O9 — CID 67796198
(2S,3R,4S,5R,6R)-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-3,4,5-triol (PubChem CID 67796198) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 67796198 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-6-(hydroxymethyl)-2-naphthalen-1-yloxane-3,4,5-triol |
| SMILES | OCCOCCOCCO[C@@]1(c2cccc3ccccc23)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H30O9/c23-8-9-28-10-11-29-12-13-30-22(21(27)20(26)19(25)18(14-24)31-22)17-7-3-5-15-4-1-2-6-16(15)17/h1-7,18-21,23-27H,8-14H2/t18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | NLOYTRSVYORVDT-CTWRKMMKSA-N |
| XLogP | -0.49 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|