About 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride
3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride (PubChem CID 67796301) has the molecular formula C21H16Cl2N4O
and a molecular weight of 411.29 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride |
| PubChem CID | 67796301 |
| Molecular Formula | C21H16Cl2N4O |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride |
| SMILES | Cl.Clc1cccc(-c2cc(-n3cc(Cn4ccnc4)c4ccccc43)on2)c1 |
| InChI | InChI=1S/C21H15ClN4O.ClH/c22-17-5-3-4-15(10-17)19-11-21(27-24-19)26-13-16(12-25-9-8-23-14-25)18-6-1-2-7-20(18)26;/h1-11,13-14H,12H2;1H |
| InChIKey | UHYFSHLXQZUUME-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride?
The IUPAC name of 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride (CID 67796301) is 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride.
What is the SMILES notation for 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride?
The canonical SMILES for 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride is Cl.Clc1cccc(-c2cc(-n3cc(Cn4ccnc4)c4ccccc43)on2)c1.
What is the InChIKey of 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride?
The InChIKey is UHYFSHLXQZUUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN4O.ClH/c22-17-5-3-4-15(10-17)19-11-21(27-24-19)26-13-16(12-25-9-8-23-14-25)18-6-1-2-7-20(18)26;/h1-11,13-14H,12H2;1H.
What are the key properties of 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride?
3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride has a molecular weight of 411.29 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-5-[3-(imidazol-1-ylmethyl)indol-1-yl]-1,2-oxazole;hydrochloride is sourced from PubChem (CID 67796301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).