C36H59N3O6 — CID 67796352
[(1S,2S)-2-[[benzyl(decyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 67796352) has the molecular formula C36H59N3O6 and a molecular weight of 629.88 g/mol. Its IUPAC name is [(1S,2S)-2-[[benzyl(decyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [(1S,2S)-2-[[benzyl(decyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 67796352 |
| Molecular Formula | C36H59N3O6 |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.44 |
| IUPAC Name | [(1S,2S)-2-[[benzyl(decyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCCCCN(Cc1ccccc1)C(=O)N[C@H]1CCCC[C@@H]1OC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C36H59N3O6/c1-6-7-8-9-10-11-12-18-25-39(26-28-19-14-13-15-20-28)34(42)38-29-21-16-17-22-30(29)44-31(40)23-24-37-33(41)32-35(2,3)27-43-36(4,5)45-32/h13-15,19-20,29-30,32H,6-12,16-18,21-27H2,1-5H3,(H,37,41)(H,38,42)/t29-,30-,32?/m0/s1 |
| InChIKey | DWIBRWMKDKWBGC-XNVRKLAPSA-N |
| XLogP | 6.88 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|